C9H15N3O2S — CID 66289905
3-[2-(azetidin-3-ylmethylsulfanyl)ethyl]imidazolidine-2,4-dione (PubChem CID 66289905) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 3-[2-(azetidin-3-ylmethylsulfanyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-(azetidin-3-ylmethylsulfanyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66289905 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-[2-(azetidin-3-ylmethylsulfanyl)ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCSCC1CNC1 |
| InChI | InChI=1S/C9H15N3O2S/c13-8-5-11-9(14)12(8)1-2-15-6-7-3-10-4-7/h7,10H,1-6H2,(H,11,14) |
| InChIKey | MFUWZHNBDXFLIE-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|