C13H17IN4S — CID 66307028
6-tert-butyl-5-iodo-2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine (PubChem CID 66307028) has the molecular formula C13H17IN4S and a molecular weight of 388.28 g/mol. Its IUPAC name is 6-tert-butyl-5-iodo-2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine.
| Compound Name | 6-tert-butyl-5-iodo-2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66307028 |
| Molecular Formula | C13H17IN4S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 6-tert-butyl-5-iodo-2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1nc(Cc2nc(N)c(I)c(C(C)(C)C)n2)cs1 |
| InChI | InChI=1S/C13H17IN4S/c1-7-16-8(6-19-7)5-9-17-11(13(2,3)4)10(14)12(15)18-9/h6H,5H2,1-4H3,(H2,15,17,18) |
| InChIKey | GFAJACGFLNEDGE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|