C10H11IN4S — CID 66307490
5-iodo-6-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine (PubChem CID 66307490) has the molecular formula C10H11IN4S and a molecular weight of 346.20 g/mol. Its IUPAC name is 5-iodo-6-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine.
| Compound Name | 5-iodo-6-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66307490 |
| Molecular Formula | C10H11IN4S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 5-iodo-6-methyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1nc(Cc2nc(C)c(I)c(N)n2)cs1 |
| InChI | InChI=1S/C10H11IN4S/c1-5-9(11)10(12)15-8(13-5)3-7-4-16-6(2)14-7/h4H,3H2,1-2H3,(H2,12,13,15) |
| InChIKey | AYBJQSVFHNQECZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|