C15H11ClIN3S — CID 66292710
4-[(4-chloro-5-iodo-6-phenylpyrimidin-2-yl)methyl]-2-methyl-1,3-thiazole (PubChem CID 66292710) has the molecular formula C15H11ClIN3S and a molecular weight of 427.70 g/mol. Its IUPAC name is 4-[(4-chloro-5-iodo-6-phenylpyrimidin-2-yl)methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[(4-chloro-5-iodo-6-phenylpyrimidin-2-yl)methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 66292710 |
| Molecular Formula | C15H11ClIN3S |
| Molecular Weight | 427.70 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 4-[(4-chloro-5-iodo-6-phenylpyrimidin-2-yl)methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(Cc2nc(Cl)c(I)c(-c3ccccc3)n2)cs1 |
| InChI | InChI=1S/C15H11ClIN3S/c1-9-18-11(8-21-9)7-12-19-14(13(17)15(16)20-12)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| InChIKey | SHCCSFRLQWYZPI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.70 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|