C11H11ClIN3OS — CID 66292433
4-[[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 66292433) has the molecular formula C11H11ClIN3OS and a molecular weight of 395.65 g/mol. Its IUPAC name is 4-[[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 66292433 |
| Molecular Formula | C11H11ClIN3OS |
| Molecular Weight | 395.65 g/mol |
| Exact Mass | 394.94 |
| IUPAC Name | 4-[[4-chloro-5-iodo-6-(methoxymethyl)pyrimidin-2-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | COCc1nc(Cc2csc(C)n2)nc(Cl)c1I |
| InChI | InChI=1S/C11H11ClIN3OS/c1-6-14-7(5-18-6)3-9-15-8(4-17-2)10(13)11(12)16-9/h5H,3-4H2,1-2H3 |
| InChIKey | TXBAXFGVHUURDH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.65 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|