C10H12IN5O — CID 66310547
5-iodo-3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one (PubChem CID 66310547) has the molecular formula C10H12IN5O and a molecular weight of 345.14 g/mol. Its IUPAC name is 5-iodo-3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one.
| Compound Name | 5-iodo-3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 66310547 |
| Molecular Formula | C10H12IN5O |
| Molecular Weight | 345.14 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 5-iodo-3-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrimidin-4-one |
| SMILES | CC(C)n1ncnc1Cn1cncc(I)c1=O |
| InChI | InChI=1S/C10H12IN5O/c1-7(2)16-9(13-5-14-16)4-15-6-12-3-8(11)10(15)17/h3,5-7H,4H2,1-2H3 |
| InChIKey | DLULJALNKNCOBD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.14 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|