C12H21N3O2 — CID 66327907
2-[(6-ethoxy-5-methylpyrimidin-4-yl)amino]-2-methylbutan-1-ol (PubChem CID 66327907) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-[(6-ethoxy-5-methylpyrimidin-4-yl)amino]-2-methylbutan-1-ol.
| Compound Name | 2-[(6-ethoxy-5-methylpyrimidin-4-yl)amino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 66327907 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 2-[(6-ethoxy-5-methylpyrimidin-4-yl)amino]-2-methylbutan-1-ol |
| SMILES | CCOc1ncnc(NC(C)(CC)CO)c1C |
| InChI | InChI=1S/C12H21N3O2/c1-5-12(4,7-16)15-10-9(3)11(17-6-2)14-8-13-10/h8,16H,5-7H2,1-4H3,(H,13,14,15) |
| InChIKey | CTVHDTMNLGSSRK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |