C17H32O3 — CID 66339015
tert-butyl 2-(5-methyl-2-propan-2-ylcyclohexyl)oxypropanoate (PubChem CID 66339015) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is tert-butyl 2-(5-methyl-2-propan-2-ylcyclohexyl)oxypropanoate.
| Compound Name | tert-butyl 2-(5-methyl-2-propan-2-ylcyclohexyl)oxypropanoate |
|---|---|
| PubChem CID | 66339015 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | tert-butyl 2-(5-methyl-2-propan-2-ylcyclohexyl)oxypropanoate |
| SMILES | CC1CCC(C(C)C)C(OC(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H32O3/c1-11(2)14-9-8-12(3)10-15(14)19-13(4)16(18)20-17(5,6)7/h11-15H,8-10H2,1-7H3 |
| InChIKey | SSZVXXWONVDHJW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |