C12H18O2S — CID 66343326
2-ethyl-2-methyl-3-(thiophen-2-ylmethoxy)cyclobutan-1-ol (PubChem CID 66343326) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-ethyl-2-methyl-3-(thiophen-2-ylmethoxy)cyclobutan-1-ol.
| Compound Name | 2-ethyl-2-methyl-3-(thiophen-2-ylmethoxy)cyclobutan-1-ol |
|---|---|
| PubChem CID | 66343326 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-ethyl-2-methyl-3-(thiophen-2-ylmethoxy)cyclobutan-1-ol |
| SMILES | CCC1(C)C(O)CC1OCc1cccs1 |
| InChI | InChI=1S/C12H18O2S/c1-3-12(2)10(13)7-11(12)14-8-9-5-4-6-15-9/h4-6,10-11,13H,3,7-8H2,1-2H3 |
| InChIKey | CAKWWZIGIJLXQD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |