C15H21ClO2S — CID 172571509
(1S,2R,4R,5S)-5-chloro-1-methyl-4-propan-2-yl-2-(thiophen-2-ylmethoxy)-7-oxabicyclo[2.2.1]heptane (PubChem CID 172571509) has the molecular formula C15H21ClO2S and a molecular weight of 300.85 g/mol. Its IUPAC name is (1S,2R,4R,5S)-5-chloro-1-methyl-4-propan-2-yl-2-(thiophen-2-ylmethoxy)-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1S,2R,4R,5S)-5-chloro-1-methyl-4-propan-2-yl-2-(thiophen-2-ylmethoxy)-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 172571509 |
| Molecular Formula | C15H21ClO2S |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (1S,2R,4R,5S)-5-chloro-1-methyl-4-propan-2-yl-2-(thiophen-2-ylmethoxy)-7-oxabicyclo[2.2.1]heptane |
| SMILES | CC(C)[C@]12C[C@@H](OCc3cccs3)[C@](C)(C[C@@H]1Cl)O2 |
| InChI | InChI=1S/C15H21ClO2S/c1-10(2)15-8-13(14(3,18-15)7-12(15)16)17-9-11-5-4-6-19-11/h4-6,10,12-13H,7-9H2,1-3H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | TVCGOUSIEFRGGE-LJISPDSOSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|