C15H21NO3S — CID 170702898
(NE)-N-[(1S,3R,4S)-4-methyl-1-propan-2-yl-3-(thiophen-2-ylmethoxy)-7-oxabicyclo[2.2.1]heptan-2-ylidene]hydroxylamine (PubChem CID 170702898) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is (NE)-N-[(1S,3R,4S)-4-methyl-1-propan-2-yl-3-(thiophen-2-ylmethoxy)-7-oxabicyclo[2.2.1]heptan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,3R,4S)-4-methyl-1-propan-2-yl-3-(thiophen-2-ylmethoxy)-7-oxabicyclo[2.2.1]heptan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 170702898 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (NE)-N-[(1S,3R,4S)-4-methyl-1-propan-2-yl-3-(thiophen-2-ylmethoxy)-7-oxabicyclo[2.2.1]heptan-2-ylidene]hydroxylamine |
| SMILES | CC(C)[C@]12CC[C@](C)(O1)[C@H](OCc1cccs1)/C2=N\O |
| InChI | InChI=1S/C15H21NO3S/c1-10(2)15-7-6-14(3,19-15)13(12(15)16-17)18-9-11-5-4-8-20-11/h4-5,8,10,13,17H,6-7,9H2,1-3H3/b16-12+/t13-,14+,15+/m1/s1 |
| InChIKey | KPCUBLSQDOWSSQ-FRXRERHHSA-N |
| XLogP | 3.44 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|