C16H31BrO — CID 66343642
2-bromo-1,1-diethyl-4-octan-2-yloxycyclobutane (PubChem CID 66343642) has the molecular formula C16H31BrO and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-bromo-1,1-diethyl-4-octan-2-yloxycyclobutane.
| Compound Name | 2-bromo-1,1-diethyl-4-octan-2-yloxycyclobutane |
|---|---|
| PubChem CID | 66343642 |
| Molecular Formula | C16H31BrO |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-bromo-1,1-diethyl-4-octan-2-yloxycyclobutane |
| SMILES | CCCCCCC(C)OC1CC(Br)C1(CC)CC |
| InChI | InChI=1S/C16H31BrO/c1-5-8-9-10-11-13(4)18-15-12-14(17)16(15,6-2)7-3/h13-15H,5-12H2,1-4H3 |
| InChIKey | OBMUJKBRTGYTHG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|