C15H29BrO4 — CID 104567988
2-bromo-1,1-diethyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclobutane (PubChem CID 104567988) has the molecular formula C15H29BrO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is 2-bromo-1,1-diethyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclobutane.
| Compound Name | 2-bromo-1,1-diethyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclobutane |
|---|---|
| PubChem CID | 104567988 |
| Molecular Formula | C15H29BrO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-bromo-1,1-diethyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]cyclobutane |
| SMILES | CCC1(CC)C(Br)CC1OCCOCCOCCOC |
| InChI | InChI=1S/C15H29BrO4/c1-4-15(5-2)13(16)12-14(15)20-11-10-19-9-8-18-7-6-17-3/h13-14H,4-12H2,1-3H3 |
| InChIKey | VHGHCEWAGQNNRV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|