C13H27NO3 — CID 113427576
2-ethyl-3-[2-(2-methoxyethoxy)ethoxy]-N,2-dimethylcyclobutan-1-amine (PubChem CID 113427576) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is 2-ethyl-3-[2-(2-methoxyethoxy)ethoxy]-N,2-dimethylcyclobutan-1-amine.
| Compound Name | 2-ethyl-3-[2-(2-methoxyethoxy)ethoxy]-N,2-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 113427576 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 2-ethyl-3-[2-(2-methoxyethoxy)ethoxy]-N,2-dimethylcyclobutan-1-amine |
| SMILES | CCC1(C)C(NC)CC1OCCOCCOC |
| InChI | InChI=1S/C13H27NO3/c1-5-13(2)11(14-3)10-12(13)17-9-8-16-7-6-15-4/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | RVLXPFSNEJQWOM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|