C18H25ClO — CID 66345937
1-(3-chloro-2,2-diethylcyclobutyl)oxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 66345937) has the molecular formula C18H25ClO and a molecular weight of 292.85 g/mol. Its IUPAC name is 1-(3-chloro-2,2-diethylcyclobutyl)oxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(3-chloro-2,2-diethylcyclobutyl)oxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 66345937 |
| Molecular Formula | C18H25ClO |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-(3-chloro-2,2-diethylcyclobutyl)oxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCC1(CC)C(Cl)CC1OC1CCCc2ccccc21 |
| InChI | InChI=1S/C18H25ClO/c1-3-18(4-2)16(19)12-17(18)20-15-11-7-9-13-8-5-6-10-14(13)15/h5-6,8,10,15-17H,3-4,7,9,11-12H2,1-2H3 |
| InChIKey | COGJOYCKQOPNBZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|