C12H10F3NOS — CID 66352968
N-[[2-(trifluoromethoxy)phenyl]methyl]thiophen-3-amine (PubChem CID 66352968) has the molecular formula C12H10F3NOS and a molecular weight of 273.28 g/mol. Its IUPAC name is N-[[2-(trifluoromethoxy)phenyl]methyl]thiophen-3-amine.
| Compound Name | N-[[2-(trifluoromethoxy)phenyl]methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66352968 |
| Molecular Formula | C12H10F3NOS |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-[[2-(trifluoromethoxy)phenyl]methyl]thiophen-3-amine |
| SMILES | FC(F)(F)Oc1ccccc1CNc1ccsc1 |
| InChI | InChI=1S/C12H10F3NOS/c13-12(14,15)17-11-4-2-1-3-9(11)7-16-10-5-6-18-8-10/h1-6,8,16H,7H2 |
| InChIKey | ZWYVVTWCIVBXBP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |