C13H7F7N2O — CID 133370814
2,3,5,6-tetrafluoro-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridin-4-amine (PubChem CID 133370814) has the molecular formula C13H7F7N2O and a molecular weight of 340.20 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133370814 |
| Molecular Formula | C13H7F7N2O |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(NCc2ccccc2OC(F)(F)F)c1F |
| InChI | InChI=1S/C13H7F7N2O/c14-8-10(9(15)12(17)22-11(8)16)21-5-6-3-1-2-4-7(6)23-13(18,19)20/h1-4H,5H2,(H,21,22) |
| InChIKey | VGIPXRISMGNGMS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|