C12H16BrNO — CID 66359628
3-(2-bromophenoxy)-2,2-dimethylcyclobutan-1-amine (PubChem CID 66359628) has the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. Its IUPAC name is 3-(2-bromophenoxy)-2,2-dimethylcyclobutan-1-amine.
| Compound Name | 3-(2-bromophenoxy)-2,2-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 66359628 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3-(2-bromophenoxy)-2,2-dimethylcyclobutan-1-amine |
| SMILES | CC1(C)C(N)CC1Oc1ccccc1Br |
| InChI | InChI=1S/C12H16BrNO/c1-12(2)10(14)7-11(12)15-9-6-4-3-5-8(9)13/h3-6,10-11H,7,14H2,1-2H3 |
| InChIKey | KBOHWWKKGGRULE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |