About 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine
3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine (PubChem CID 66357748) has the molecular formula C14H20ClNO
and a molecular weight of 253.77 g/mol. Its IUPAC name is 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine.
Molecular Properties
| Compound Name | 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine |
| PubChem CID | 66357748 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine |
| SMILES | Cc1cc(Cl)cc(C)c1OC1CC(N)C1(C)C |
| InChI | InChI=1S/C14H20ClNO/c1-8-5-10(15)6-9(2)13(8)17-12-7-11(16)14(12,3)4/h5-6,11-12H,7,16H2,1-4H3 |
| InChIKey | HJTQTJCJDKOQSS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine?
The IUPAC name of 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine (CID 66357748) is 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine.
What is the SMILES notation for 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine?
The canonical SMILES for 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine is Cc1cc(Cl)cc(C)c1OC1CC(N)C1(C)C.
What is the InChIKey of 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine?
The InChIKey is HJTQTJCJDKOQSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO/c1-8-5-10(15)6-9(2)13(8)17-12-7-11(16)14(12,3)4/h5-6,11-12H,7,16H2,1-4H3.
What are the key properties of 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine?
3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine has a molecular weight of 253.77 g/mol, XLogP of 3.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-2,6-dimethylphenoxy)-2,2-dimethylcyclobutan-1-amine is sourced from PubChem (CID 66357748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).