About 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol
2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol (PubChem CID 66360581) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol |
| PubChem CID | 66360581 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol |
| SMILES | Cc1ccc2c(c1)CC(CNC1CCCCC1O)O2 |
| InChI | InChI=1S/C16H23NO2/c1-11-6-7-16-12(8-11)9-13(19-16)10-17-14-4-2-3-5-15(14)18/h6-8,13-15,17-18H,2-5,9-10H2,1H3 |
| InChIKey | IVTHXDXNLNQAHZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol?
The IUPAC name of 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol (CID 66360581) is 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol.
What is the SMILES notation for 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol?
The canonical SMILES for 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol is Cc1ccc2c(c1)CC(CNC1CCCCC1O)O2.
What is the InChIKey of 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol?
The InChIKey is IVTHXDXNLNQAHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-11-6-7-16-12(8-11)9-13(19-16)10-17-14-4-2-3-5-15(14)18/h6-8,13-15,17-18H,2-5,9-10H2,1H3.
What are the key properties of 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol?
2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol has a molecular weight of 261.37 g/mol, XLogP of 2.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methylamino]cyclohexan-1-ol is sourced from PubChem (CID 66360581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).