C17H25FN2O — CID 66365688
N-[[1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]pyrrolidin-2-yl]methyl]propan-1-amine (PubChem CID 66365688) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[[1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]pyrrolidin-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]pyrrolidin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66365688 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | N-[[1-[(5-fluoro-2,3-dihydro-1-benzofuran-2-yl)methyl]pyrrolidin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCN1CC1Cc2cc(F)ccc2O1 |
| InChI | InChI=1S/C17H25FN2O/c1-2-7-19-11-15-4-3-8-20(15)12-16-10-13-9-14(18)5-6-17(13)21-16/h5-6,9,15-16,19H,2-4,7-8,10-12H2,1H3 |
| InChIKey | JMBIAZMWVISDNQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|