C12H15FO2 — CID 66368118
3-(3-fluorophenoxy)-2,2-dimethylcyclobutan-1-ol (PubChem CID 66368118) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 3-(3-fluorophenoxy)-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-(3-fluorophenoxy)-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 66368118 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-(3-fluorophenoxy)-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1Oc1cccc(F)c1 |
| InChI | InChI=1S/C12H15FO2/c1-12(2)10(14)7-11(12)15-9-5-3-4-8(13)6-9/h3-6,10-11,14H,7H2,1-2H3 |
| InChIKey | ZTXDPBMCIUODEH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |