C15H13ClINO2 — CID 66369088
3-(5-chloro-7-iodoquinolin-8-yl)oxy-2,2-dimethylcyclobutan-1-one (PubChem CID 66369088) has the molecular formula C15H13ClINO2 and a molecular weight of 401.63 g/mol. Its IUPAC name is 3-(5-chloro-7-iodoquinolin-8-yl)oxy-2,2-dimethylcyclobutan-1-one.
| Compound Name | 3-(5-chloro-7-iodoquinolin-8-yl)oxy-2,2-dimethylcyclobutan-1-one |
|---|---|
| PubChem CID | 66369088 |
| Molecular Formula | C15H13ClINO2 |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 3-(5-chloro-7-iodoquinolin-8-yl)oxy-2,2-dimethylcyclobutan-1-one |
| SMILES | CC1(C)C(=O)CC1Oc1c(I)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C15H13ClINO2/c1-15(2)11(19)7-12(15)20-14-10(17)6-9(16)8-4-3-5-18-13(8)14/h3-6,12H,7H2,1-2H3 |
| InChIKey | KGADNZUXLGGANW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|