C11H16N2O3S2 — CID 66372279
[5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)thiophen-3-yl]methanamine (PubChem CID 66372279) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is [5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)thiophen-3-yl]methanamine.
| Compound Name | [5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)thiophen-3-yl]methanamine |
|---|---|
| PubChem CID | 66372279 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | [5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)thiophen-3-yl]methanamine |
| SMILES | NCc1csc(S(=O)(=O)N2CC3CCC(C2)O3)c1 |
| InChI | InChI=1S/C11H16N2O3S2/c12-4-8-3-11(17-7-8)18(14,15)13-5-9-1-2-10(6-13)16-9/h3,7,9-10H,1-2,4-6,12H2 |
| InChIKey | KJIHOZRTZREAPQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |