2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid

C10H10N4O2S — CID 66375481

IUPAC2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid
SMILESCC(Nc1ccncn1)c1nc(C(=O)O)cs1
InChIInChI=1S/C10H10N4O2S/c1-6(13-8-2-3-11-5-12-8)9-14-7(4-17-9)10(15)16/h2-6H,1H3,(H,15,16)(H,11,12,13)
InChIKeyCXYDWIZGFZRETE-UHFFFAOYSA-N
MW250.28 g/mol
LogP1.80
Rot. Bonds4

About 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid

2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66375481) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid
PubChem CID66375481
Molecular FormulaC10H10N4O2S
Molecular Weight250.28 g/mol
Exact Mass250.05
IUPAC Name2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid
SMILESCC(Nc1ccncn1)c1nc(C(=O)O)cs1
InChIInChI=1S/C10H10N4O2S/c1-6(13-8-2-3-11-5-12-8)9-14-7(4-17-9)10(15)16/h2-6H,1H3,(H,15,16)(H,11,12,13)
InChIKeyCXYDWIZGFZRETE-UHFFFAOYSA-N
XLogP1.80
TPSA88.00 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.28
LogP ≤ 51.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid (CID 66375481) is 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid is CC(Nc1ccncn1)c1nc(C(=O)O)cs1.
What is the InChIKey of 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is CXYDWIZGFZRETE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2S/c1-6(13-8-2-3-11-5-12-8)9-14-7(4-17-9)10(15)16/h2-6H,1H3,(H,15,16)(H,11,12,13).
What are the key properties of 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid?
2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 250.28 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(pyrimidin-4-ylamino)ethyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 66375481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).