C17H24N2S — CID 66385138
2-[[2,4-di(propan-2-yl)anilino]methyl]thiophen-3-amine (PubChem CID 66385138) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 2-[[2,4-di(propan-2-yl)anilino]methyl]thiophen-3-amine.
| Compound Name | 2-[[2,4-di(propan-2-yl)anilino]methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66385138 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[[2,4-di(propan-2-yl)anilino]methyl]thiophen-3-amine |
| SMILES | CC(C)c1ccc(NCc2sccc2N)c(C(C)C)c1 |
| InChI | InChI=1S/C17H24N2S/c1-11(2)13-5-6-16(14(9-13)12(3)4)19-10-17-15(18)7-8-20-17/h5-9,11-12,19H,10,18H2,1-4H3 |
| InChIKey | WMTQXGOVPPYMQD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |