C13H14BrN3 — CID 66395267
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-(2-bromoethyl)triazole (PubChem CID 66395267) has the molecular formula C13H14BrN3 and a molecular weight of 292.18 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-(2-bromoethyl)triazole.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-(2-bromoethyl)triazole |
|---|---|
| PubChem CID | 66395267 |
| Molecular Formula | C13H14BrN3 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-(2-bromoethyl)triazole |
| SMILES | BrCCc1cn(CC2Cc3ccccc32)nn1 |
| InChI | InChI=1S/C13H14BrN3/c14-6-5-12-9-17(16-15-12)8-11-7-10-3-1-2-4-13(10)11/h1-4,9,11H,5-8H2 |
| InChIKey | OOOAMCNBRHTUAR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|