C15H18N4O — CID 66398883
[1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indol-3-yl]methanol (PubChem CID 66398883) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is [1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indol-3-yl]methanol.
| Compound Name | [1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indol-3-yl]methanol |
|---|---|
| PubChem CID | 66398883 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indol-3-yl]methanol |
| SMILES | CCCn1ncnc1Cn1cc(CO)c2ccccc21 |
| InChI | InChI=1S/C15H18N4O/c1-2-7-19-15(16-11-17-19)9-18-8-12(10-20)13-5-3-4-6-14(13)18/h3-6,8,11,20H,2,7,9-10H2,1H3 |
| InChIKey | DCAJOZSKVRWDQL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |