C10H13N5O — CID 116618362
1-[(2-propyl-1,2,4-triazol-3-yl)methyl]pyrimidin-2-one (PubChem CID 116618362) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 1-[(2-propyl-1,2,4-triazol-3-yl)methyl]pyrimidin-2-one.
| Compound Name | 1-[(2-propyl-1,2,4-triazol-3-yl)methyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 116618362 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-[(2-propyl-1,2,4-triazol-3-yl)methyl]pyrimidin-2-one |
| SMILES | CCCn1ncnc1Cn1cccnc1=O |
| InChI | InChI=1S/C10H13N5O/c1-2-5-15-9(12-8-13-15)7-14-6-3-4-11-10(14)16/h3-4,6,8H,2,5,7H2,1H3 |
| InChIKey | QRWOAYNSZIJEAE-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |