C14H15N5O2 — CID 116623428
4-nitro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indole (PubChem CID 116623428) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 4-nitro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indole.
| Compound Name | 4-nitro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indole |
|---|---|
| PubChem CID | 116623428 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-nitro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indole |
| SMILES | CCCn1ncnc1Cn1ccc2c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C14H15N5O2/c1-2-7-18-14(15-10-16-18)9-17-8-6-11-12(17)4-3-5-13(11)19(20)21/h3-6,8,10H,2,7,9H2,1H3 |
| InChIKey | AIYFAFAJIKEUEZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|