C16H20N4O — CID 83166124
1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-propoxyindole (PubChem CID 83166124) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-propoxyindole.
| Compound Name | 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-propoxyindole |
|---|---|
| PubChem CID | 83166124 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-propoxyindole |
| SMILES | CCCOc1cccc2c1ccn2Cc1ncnn1CC |
| InChI | InChI=1S/C16H20N4O/c1-3-10-21-15-7-5-6-14-13(15)8-9-19(14)11-16-17-12-18-20(16)4-2/h5-9,12H,3-4,10-11H2,1-2H3 |
| InChIKey | GEYKCGQIPACJRW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |