C14H15FN4 — CID 82795063
4-fluoro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indole (PubChem CID 82795063) has the molecular formula C14H15FN4 and a molecular weight of 258.30 g/mol. Its IUPAC name is 4-fluoro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indole.
| Compound Name | 4-fluoro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indole |
|---|---|
| PubChem CID | 82795063 |
| Molecular Formula | C14H15FN4 |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 4-fluoro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]indole |
| SMILES | CCCn1ncnc1Cn1ccc2c(F)cccc21 |
| InChI | InChI=1S/C14H15FN4/c1-2-7-19-14(16-10-17-19)9-18-8-6-11-12(15)4-3-5-13(11)18/h3-6,8,10H,2,7,9H2,1H3 |
| InChIKey | PZZDFAXQIOSZLK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |