C10H16F2N2 — CID 66402051
N-[[1-(difluoromethyl)pyrrol-2-yl]methyl]-2-methylpropan-1-amine (PubChem CID 66402051) has the molecular formula C10H16F2N2 and a molecular weight of 202.25 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)pyrrol-2-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(difluoromethyl)pyrrol-2-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 66402051 |
| Molecular Formula | C10H16F2N2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | N-[[1-(difluoromethyl)pyrrol-2-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cccn1C(F)F |
| InChI | InChI=1S/C10H16F2N2/c1-8(2)6-13-7-9-4-3-5-14(9)10(11)12/h3-5,8,10,13H,6-7H2,1-2H3 |
| InChIKey | RDXOEEMKKJROKS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |