C10H18N2OS — CID 115764127
N-[(1-methylpyrrol-2-yl)methyl]-2-methylsulfinylpropan-1-amine (PubChem CID 115764127) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]-2-methylsulfinylpropan-1-amine.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]-2-methylsulfinylpropan-1-amine |
|---|---|
| PubChem CID | 115764127 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]-2-methylsulfinylpropan-1-amine |
| SMILES | CC(CNCc1cccn1C)S(C)=O |
| InChI | InChI=1S/C10H18N2OS/c1-9(14(3)13)7-11-8-10-5-4-6-12(10)2/h4-6,9,11H,7-8H2,1-3H3 |
| InChIKey | UDOVHDDHEJNZKR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |