C17H24N4 — CID 66402598
N-[[1-[(1-cyclopentylpyrazol-3-yl)methyl]pyrrol-2-yl]methyl]cyclopropanamine (PubChem CID 66402598) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-[[1-[(1-cyclopentylpyrazol-3-yl)methyl]pyrrol-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[(1-cyclopentylpyrazol-3-yl)methyl]pyrrol-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 66402598 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N-[[1-[(1-cyclopentylpyrazol-3-yl)methyl]pyrrol-2-yl]methyl]cyclopropanamine |
| SMILES | c1cc(CNC2CC2)n(Cc2ccn(C3CCCC3)n2)c1 |
| InChI | InChI=1S/C17H24N4/c1-2-5-16(4-1)21-11-9-15(19-21)13-20-10-3-6-17(20)12-18-14-7-8-14/h3,6,9-11,14,16,18H,1-2,4-5,7-8,12-13H2 |
| InChIKey | HAKFZRSFIDNNNK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |