C18H21N3 — CID 116620406
1-[(1-cyclopentylpyrazol-3-yl)methyl]-4-methylindole (PubChem CID 116620406) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is 1-[(1-cyclopentylpyrazol-3-yl)methyl]-4-methylindole.
| Compound Name | 1-[(1-cyclopentylpyrazol-3-yl)methyl]-4-methylindole |
|---|---|
| PubChem CID | 116620406 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1-[(1-cyclopentylpyrazol-3-yl)methyl]-4-methylindole |
| SMILES | Cc1cccc2c1ccn2Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C18H21N3/c1-14-5-4-8-18-17(14)10-11-20(18)13-15-9-12-21(19-15)16-6-2-3-7-16/h4-5,8-12,16H,2-3,6-7,13H2,1H3 |
| InChIKey | GNHYRXSQGLARJG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |