C17H25N3 — CID 64776964
1-cyclohexyl-3-[(2,3,4-trimethylpyrrol-1-yl)methyl]pyrazole (PubChem CID 64776964) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2,3,4-trimethylpyrrol-1-yl)methyl]pyrazole.
| Compound Name | 1-cyclohexyl-3-[(2,3,4-trimethylpyrrol-1-yl)methyl]pyrazole |
|---|---|
| PubChem CID | 64776964 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1-cyclohexyl-3-[(2,3,4-trimethylpyrrol-1-yl)methyl]pyrazole |
| SMILES | Cc1cn(Cc2ccn(C3CCCCC3)n2)c(C)c1C |
| InChI | InChI=1S/C17H25N3/c1-13-11-19(15(3)14(13)2)12-16-9-10-20(18-16)17-7-5-4-6-8-17/h9-11,17H,4-8,12H2,1-3H3 |
| InChIKey | LQRUATPKOXSNLW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |