C15H22N4 — CID 64779569
1-[(1-cyclohexylpyrazol-3-yl)methyl]-3,5-dimethylpyrazole (PubChem CID 64779569) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-[(1-cyclohexylpyrazol-3-yl)methyl]-3,5-dimethylpyrazole.
| Compound Name | 1-[(1-cyclohexylpyrazol-3-yl)methyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 64779569 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 1-[(1-cyclohexylpyrazol-3-yl)methyl]-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(Cc2ccn(C3CCCCC3)n2)n1 |
| InChI | InChI=1S/C15H22N4/c1-12-10-13(2)19(16-12)11-14-8-9-18(17-14)15-6-4-3-5-7-15/h8-10,15H,3-7,11H2,1-2H3 |
| InChIKey | BHSQOOYJODKSFI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |