C7H10F2N2 — CID 66405503
1-[1-(difluoromethyl)pyrrol-3-yl]-N-methylmethanamine (PubChem CID 66405503) has the molecular formula C7H10F2N2 and a molecular weight of 160.17 g/mol. Its IUPAC name is 1-[1-(difluoromethyl)pyrrol-3-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(difluoromethyl)pyrrol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 66405503 |
| Molecular Formula | C7H10F2N2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 1-[1-(difluoromethyl)pyrrol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1ccn(C(F)F)c1 |
| InChI | InChI=1S/C7H10F2N2/c1-10-4-6-2-3-11(5-6)7(8)9/h2-3,5,7,10H,4H2,1H3 |
| InChIKey | ZGAOOLVQWYSGCY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |