C9H16N2O — CID 66406506
1-[3-(methylaminomethyl)pyrrol-1-yl]propan-2-ol (PubChem CID 66406506) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-[3-(methylaminomethyl)pyrrol-1-yl]propan-2-ol.
| Compound Name | 1-[3-(methylaminomethyl)pyrrol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 66406506 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-[3-(methylaminomethyl)pyrrol-1-yl]propan-2-ol |
| SMILES | CNCc1ccn(CC(C)O)c1 |
| InChI | InChI=1S/C9H16N2O/c1-8(12)6-11-4-3-9(7-11)5-10-2/h3-4,7-8,10,12H,5-6H2,1-2H3 |
| InChIKey | GUAXHGCMOXCIPE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |