C17H14ClIN2 — CID 66410408
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-(chloromethyl)-5-iodobenzimidazole (PubChem CID 66410408) has the molecular formula C17H14ClIN2 and a molecular weight of 408.67 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-(chloromethyl)-5-iodobenzimidazole.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-(chloromethyl)-5-iodobenzimidazole |
|---|---|
| PubChem CID | 66410408 |
| Molecular Formula | C17H14ClIN2 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-2-(chloromethyl)-5-iodobenzimidazole |
| SMILES | ClCc1nc2cc(I)ccc2n1CC1Cc2ccccc21 |
| InChI | InChI=1S/C17H14ClIN2/c18-9-17-20-15-8-13(19)5-6-16(15)21(17)10-12-7-11-3-1-2-4-14(11)12/h1-6,8,12H,7,9-10H2 |
| InChIKey | UBEAKIIYNWUEKI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|