About 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine
2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine (PubChem CID 66411058) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine |
| PubChem CID | 66411058 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine |
| SMILES | CCCCCCn1cc(CCN)c2cccnc21 |
| InChI | InChI=1S/C15H23N3/c1-2-3-4-5-11-18-12-13(8-9-16)14-7-6-10-17-15(14)18/h6-7,10,12H,2-5,8-9,11,16H2,1H3 |
| InChIKey | PGMPQMFABSMQLW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine?
The IUPAC name of 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine (CID 66411058) is 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine.
What is the SMILES notation for 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine?
The canonical SMILES for 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine is CCCCCCn1cc(CCN)c2cccnc21.
What is the InChIKey of 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine?
The InChIKey is PGMPQMFABSMQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3/c1-2-3-4-5-11-18-12-13(8-9-16)14-7-6-10-17-15(14)18/h6-7,10,12H,2-5,8-9,11,16H2,1H3.
What are the key properties of 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine?
2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine has a molecular weight of 245.37 g/mol, XLogP of 3.12, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hexylpyrrolo[2,3-b]pyridin-3-yl)ethanamine is sourced from PubChem (CID 66411058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).