C10H13N3 — CID 66414119
(1-ethylpyrrolo[2,3-b]pyridin-3-yl)methanamine (PubChem CID 66414119) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is (1-ethylpyrrolo[2,3-b]pyridin-3-yl)methanamine.
| Compound Name | (1-ethylpyrrolo[2,3-b]pyridin-3-yl)methanamine |
|---|---|
| PubChem CID | 66414119 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | (1-ethylpyrrolo[2,3-b]pyridin-3-yl)methanamine |
| SMILES | CCn1cc(CN)c2cccnc21 |
| InChI | InChI=1S/C10H13N3/c1-2-13-7-8(6-11)9-4-3-5-12-10(9)13/h3-5,7H,2,6,11H2,1H3 |
| InChIKey | WRRFCPOKLVYFHS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |