C14H19N3O2 — CID 66415107
butyl 2-[3-(aminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate (PubChem CID 66415107) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is butyl 2-[3-(aminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate.
| Compound Name | butyl 2-[3-(aminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate |
|---|---|
| PubChem CID | 66415107 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | butyl 2-[3-(aminomethyl)pyrrolo[2,3-b]pyridin-1-yl]acetate |
| SMILES | CCCCOC(=O)Cn1cc(CN)c2cccnc21 |
| InChI | InChI=1S/C14H19N3O2/c1-2-3-7-19-13(18)10-17-9-11(8-15)12-5-4-6-16-14(12)17/h4-6,9H,2-3,7-8,10,15H2,1H3 |
| InChIKey | NFEDRQOAPPQFGG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|