C14H16N2O3 — CID 66416024
butyl 2-(3-formylpyrrolo[2,3-b]pyridin-1-yl)acetate (PubChem CID 66416024) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is butyl 2-(3-formylpyrrolo[2,3-b]pyridin-1-yl)acetate.
| Compound Name | butyl 2-(3-formylpyrrolo[2,3-b]pyridin-1-yl)acetate |
|---|---|
| PubChem CID | 66416024 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | butyl 2-(3-formylpyrrolo[2,3-b]pyridin-1-yl)acetate |
| SMILES | CCCCOC(=O)Cn1cc(C=O)c2cccnc21 |
| InChI | InChI=1S/C14H16N2O3/c1-2-3-7-19-13(18)9-16-8-11(10-17)12-5-4-6-15-14(12)16/h4-6,8,10H,2-3,7,9H2,1H3 |
| InChIKey | VNJYJCXGKSCOKL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|