C12H11F3N2O2 — CID 66415652
1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde (PubChem CID 66415652) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde.
| Compound Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 66415652 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[2,3-b]pyridine-3-carbaldehyde |
| SMILES | O=Cc1cn(CCOCC(F)(F)F)c2ncccc12 |
| InChI | InChI=1S/C12H11F3N2O2/c13-12(14,15)8-19-5-4-17-6-9(7-18)10-2-1-3-16-11(10)17/h1-3,6-7H,4-5,8H2 |
| InChIKey | LEASGXNWYNWGAW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|