C11H19N3O — CID 66411108
N-[2-[(1-ethylpyrrol-2-yl)methylamino]ethyl]acetamide (PubChem CID 66411108) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[2-[(1-ethylpyrrol-2-yl)methylamino]ethyl]acetamide.
| Compound Name | N-[2-[(1-ethylpyrrol-2-yl)methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 66411108 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-[2-[(1-ethylpyrrol-2-yl)methylamino]ethyl]acetamide |
| SMILES | CCn1cccc1CNCCNC(C)=O |
| InChI | InChI=1S/C11H19N3O/c1-3-14-8-4-5-11(14)9-12-6-7-13-10(2)15/h4-5,8,12H,3,6-7,9H2,1-2H3,(H,13,15) |
| InChIKey | DNZKRIYDFHOFFX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|