C11H20N2S — CID 66444811
N-[(1-ethylpyrrol-2-yl)methyl]-3-methylsulfanylpropan-1-amine (PubChem CID 66444811) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is N-[(1-ethylpyrrol-2-yl)methyl]-3-methylsulfanylpropan-1-amine.
| Compound Name | N-[(1-ethylpyrrol-2-yl)methyl]-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 66444811 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-[(1-ethylpyrrol-2-yl)methyl]-3-methylsulfanylpropan-1-amine |
| SMILES | CCn1cccc1CNCCCSC |
| InChI | InChI=1S/C11H20N2S/c1-3-13-8-4-6-11(13)10-12-7-5-9-14-2/h4,6,8,12H,3,5,7,9-10H2,1-2H3 |
| InChIKey | WGLYNRNHQAFNIR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|