C11H21N3 — CID 66411172
N'-[(1-ethylpyrrol-2-yl)methyl]butane-1,4-diamine (PubChem CID 66411172) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N'-[(1-ethylpyrrol-2-yl)methyl]butane-1,4-diamine.
| Compound Name | N'-[(1-ethylpyrrol-2-yl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 66411172 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N'-[(1-ethylpyrrol-2-yl)methyl]butane-1,4-diamine |
| SMILES | CCn1cccc1CNCCCCN |
| InChI | InChI=1S/C11H21N3/c1-2-14-9-5-6-11(14)10-13-8-4-3-7-12/h5-6,9,13H,2-4,7-8,10,12H2,1H3 |
| InChIKey | KMMCDOCFBIUORO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|