C12H12N2O — CID 66416644
(1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol (PubChem CID 66416644) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol.
| Compound Name | (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 66416644 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol |
| SMILES | CC#CCn1cc(CO)c2cccnc21 |
| InChI | InChI=1S/C12H12N2O/c1-2-3-7-14-8-10(9-15)11-5-4-6-13-12(11)14/h4-6,8,15H,7,9H2,1H3 |
| InChIKey | GDIUDQNUOMUYDM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|