About (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol
(1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol (PubChem CID 66416644) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol.
Molecular Properties
| Compound Name | (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol |
| PubChem CID | 66416644 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol |
| SMILES | CC#CCn1cc(CO)c2cccnc21 |
| InChI | InChI=1S/C12H12N2O/c1-2-3-7-14-8-10(9-15)11-5-4-6-13-12(11)14/h4-6,8,15H,7,9H2,1H3 |
| InChIKey | GDIUDQNUOMUYDM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol?
The IUPAC name of (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol (CID 66416644) is (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol.
What is the SMILES notation for (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol?
The canonical SMILES for (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol is CC#CCn1cc(CO)c2cccnc21.
What is the InChIKey of (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol?
The InChIKey is GDIUDQNUOMUYDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c1-2-3-7-14-8-10(9-15)11-5-4-6-13-12(11)14/h4-6,8,15H,7,9H2,1H3.
What are the key properties of (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol?
(1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol has a molecular weight of 200.24 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-but-2-ynylpyrrolo[2,3-b]pyridin-3-yl)methanol is sourced from PubChem (CID 66416644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).